C21H34N2O5S — CID 86706198
benzyl N-[(2R)-1-(4,4-diethoxybutylamino)-3-methyl-1-oxo-3-sulfanylbutan-2-yl]carbamate (PubChem CID 86706198) has the molecular formula C21H34N2O5S and a molecular weight of 426.58 g/mol. Its IUPAC name is benzyl N-[(2R)-1-(4,4-diethoxybutylamino)-3-methyl-1-oxo-3-sulfanylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-(4,4-diethoxybutylamino)-3-methyl-1-oxo-3-sulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86706198 |
| Molecular Formula | C21H34N2O5S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | benzyl N-[(2R)-1-(4,4-diethoxybutylamino)-3-methyl-1-oxo-3-sulfanylbutan-2-yl]carbamate |
| SMILES | CCOC(CCCNC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)(C)S)OCC |
| InChI | InChI=1S/C21H34N2O5S/c1-5-26-17(27-6-2)13-10-14-22-19(24)18(21(3,4)29)23-20(25)28-15-16-11-8-7-9-12-16/h7-9,11-12,17-18,29H,5-6,10,13-15H2,1-4H3,(H,22,24)(H,23,25)/t18-/m1/s1 |
| InChIKey | ZBBPDXPHJPRWIK-GOSISDBHSA-N |
| XLogP | 3.29 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|