C22H35NO5S — CID 147074990
benzyl N-[(3R)-9,9-diethoxy-2-methyl-4-oxo-2-sulfanylnonan-3-yl]carbamate (PubChem CID 147074990) has the molecular formula C22H35NO5S and a molecular weight of 425.59 g/mol. Its IUPAC name is benzyl N-[(3R)-9,9-diethoxy-2-methyl-4-oxo-2-sulfanylnonan-3-yl]carbamate.
| Compound Name | benzyl N-[(3R)-9,9-diethoxy-2-methyl-4-oxo-2-sulfanylnonan-3-yl]carbamate |
|---|---|
| PubChem CID | 147074990 |
| Molecular Formula | C22H35NO5S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | benzyl N-[(3R)-9,9-diethoxy-2-methyl-4-oxo-2-sulfanylnonan-3-yl]carbamate |
| SMILES | CCOC(CCCCC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)(C)S)OCC |
| InChI | InChI=1S/C22H35NO5S/c1-5-26-19(27-6-2)15-11-10-14-18(24)20(22(3,4)29)23-21(25)28-16-17-12-8-7-9-13-17/h7-9,12-13,19-20,29H,5-6,10-11,14-16H2,1-4H3,(H,23,25)/t20-/m1/s1 |
| InChIKey | BFUGHAJBXAQLDQ-HXUWFJFHSA-N |
| XLogP | 4.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|