C20H31NO3 — CID 10688108
benzyl N-[(4S)-3-methyl-5-oxoundecan-4-yl]carbamate (PubChem CID 10688108) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is benzyl N-[(4S)-3-methyl-5-oxoundecan-4-yl]carbamate.
| Compound Name | benzyl N-[(4S)-3-methyl-5-oxoundecan-4-yl]carbamate |
|---|---|
| PubChem CID | 10688108 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | benzyl N-[(4S)-3-methyl-5-oxoundecan-4-yl]carbamate |
| SMILES | CCCCCCC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)CC |
| InChI | InChI=1S/C20H31NO3/c1-4-6-7-11-14-18(22)19(16(3)5-2)21-20(23)24-15-17-12-9-8-10-13-17/h8-10,12-13,16,19H,4-7,11,14-15H2,1-3H3,(H,21,23)/t16?,19-/m0/s1 |
| InChIKey | IWNVIAJDYZZWHC-CVMIBEPCSA-N |
| XLogP | 4.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|