C21H33NO4 — CID 91699768
heptyl 3-methyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 91699768) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is heptyl 3-methyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | heptyl 3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 91699768 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | heptyl 3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCCCCCCOC(=O)C(NC(=O)OCc1ccccc1)C(C)CC |
| InChI | InChI=1S/C21H33NO4/c1-4-6-7-8-12-15-25-20(23)19(17(3)5-2)22-21(24)26-16-18-13-10-9-11-14-18/h9-11,13-14,17,19H,4-8,12,15-16H2,1-3H3,(H,22,24) |
| InChIKey | PABFITJPNABYMR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|