C18H24INO7 — CID 23387349
2-(iodomethoxycarbonyloxy)ethyl (2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 23387349) has the molecular formula C18H24INO7 and a molecular weight of 493.29 g/mol. Its IUPAC name is 2-(iodomethoxycarbonyloxy)ethyl (2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | 2-(iodomethoxycarbonyloxy)ethyl (2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 23387349 |
| Molecular Formula | C18H24INO7 |
| Molecular Weight | 493.29 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-(iodomethoxycarbonyloxy)ethyl (2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCCOC(=O)OCI |
| InChI | InChI=1S/C18H24INO7/c1-3-13(2)15(16(21)24-9-10-25-18(23)27-12-19)20-17(22)26-11-14-7-5-4-6-8-14/h4-8,13,15H,3,9-12H2,1-2H3,(H,20,22)/t13-,15-/m0/s1 |
| InChIKey | CWAJZGHPUMUMHG-ZFWWWQNUSA-N |
| XLogP | 3.42 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|