C23H26INO6 — CID 173276498
3-iodo-2-[2-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxyphenyl]propanoic acid (PubChem CID 173276498) has the molecular formula C23H26INO6 and a molecular weight of 539.37 g/mol. Its IUPAC name is 3-iodo-2-[2-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxyphenyl]propanoic acid.
| Compound Name | 3-iodo-2-[2-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 173276498 |
| Molecular Formula | C23H26INO6 |
| Molecular Weight | 539.37 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | 3-iodo-2-[2-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxyphenyl]propanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1ccccc1C(CI)C(=O)O |
| InChI | InChI=1S/C23H26INO6/c1-3-15(2)20(25-23(29)30-14-16-9-5-4-6-10-16)22(28)31-19-12-8-7-11-17(19)18(13-24)21(26)27/h4-12,15,18,20H,3,13-14H2,1-2H3,(H,25,29)(H,26,27)/t15-,18?,20-/m0/s1 |
| InChIKey | JLDHFFNYLSPHRO-JSFUQZLZSA-N |
| XLogP | 4.54 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|