C20H18F5NO4 — CID 11350929
(2,3,4,5,6-pentafluorophenyl) (2S,3R)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 11350929) has the molecular formula C20H18F5NO4 and a molecular weight of 431.36 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S,3R)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S,3R)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 11350929 |
| Molecular Formula | C20H18F5NO4 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S,3R)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H18F5NO4/c1-3-10(2)17(26-20(28)29-9-11-7-5-4-6-8-11)19(27)30-18-15(24)13(22)12(21)14(23)16(18)25/h4-8,10,17H,3,9H2,1-2H3,(H,26,28)/t10-,17+/m1/s1 |
| InChIKey | CTLNPOOMSUWDMD-QGHHPUGFSA-N |
| XLogP | 4.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|