C20H19F5N2O4 — CID 59417479
(2,3,4,5,6-pentafluorophenyl) 3-methyl-3-(methylamino)-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 59417479) has the molecular formula C20H19F5N2O4 and a molecular weight of 446.37 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-methyl-3-(methylamino)-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-methyl-3-(methylamino)-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 59417479 |
| Molecular Formula | C20H19F5N2O4 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-methyl-3-(methylamino)-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CNC(C)(C)C(NC(=O)OCc1ccccc1)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H19F5N2O4/c1-20(2,26-3)17(27-19(29)30-9-10-7-5-4-6-8-10)18(28)31-16-14(24)12(22)11(21)13(23)15(16)25/h4-8,17,26H,9H2,1-3H3,(H,27,29) |
| InChIKey | HTZMEFNHBNBHKV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|