C15H20NO4- — CID 7020253
(2R)-4,4-dimethyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 7020253) has the molecular formula C15H20NO4- and a molecular weight of 278.33 g/mol. Its IUPAC name is (2R)-4,4-dimethyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | (2R)-4,4-dimethyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 7020253 |
| Molecular Formula | C15H20NO4- |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2R)-4,4-dimethyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)(C)C[C@@H](NC(=O)OCc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C15H21NO4/c1-15(2,3)9-12(13(17)18)16-14(19)20-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/p-1/t12-/m1/s1 |
| InChIKey | ARVUWUDYYMENSJ-GFCCVEGCSA-M |
| XLogP | 1.47 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |