C19H18NO6S- — CID 7021868
(2R)-2-(phenylmethoxycarbonylamino)-3-phenylmethoxycarbonylsulfanylpropanoate (PubChem CID 7021868) has the molecular formula C19H18NO6S- and a molecular weight of 388.42 g/mol. Its IUPAC name is (2R)-2-(phenylmethoxycarbonylamino)-3-phenylmethoxycarbonylsulfanylpropanoate.
| Compound Name | (2R)-2-(phenylmethoxycarbonylamino)-3-phenylmethoxycarbonylsulfanylpropanoate |
|---|---|
| PubChem CID | 7021868 |
| Molecular Formula | C19H18NO6S- |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (2R)-2-(phenylmethoxycarbonylamino)-3-phenylmethoxycarbonylsulfanylpropanoate |
| SMILES | O=C(N[C@@H](CSC(=O)OCc1ccccc1)C(=O)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C19H19NO6S/c21-17(22)16(20-18(23)25-11-14-7-3-1-4-8-14)13-27-19(24)26-12-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,20,23)(H,21,22)/p-1/t16-/m0/s1 |
| InChIKey | PXKPRICKEUGRRR-INIZCTEOSA-M |
| XLogP | 2.10 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|