C18H12F5NO6S — CID 101449070
(2R)-2-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]-3-phenylmethoxycarbonylsulfanylpropanoic acid (PubChem CID 101449070) has the molecular formula C18H12F5NO6S and a molecular weight of 465.35 g/mol. Its IUPAC name is (2R)-2-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]-3-phenylmethoxycarbonylsulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]-3-phenylmethoxycarbonylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 101449070 |
| Molecular Formula | C18H12F5NO6S |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | (2R)-2-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]-3-phenylmethoxycarbonylsulfanylpropanoic acid |
| SMILES | O=C(N[C@@H](CSC(=O)OCc1ccccc1)C(=O)O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H12F5NO6S/c19-10-11(20)13(22)15(14(23)12(10)21)30-17(27)24-9(16(25)26)7-31-18(28)29-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,24,27)(H,25,26)/t9-/m0/s1 |
| InChIKey | MALHCXWGLYGBEZ-VIFPVBQESA-N |
| XLogP | 3.99 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|