C16H19NO7 — CID 67830750
(2S)-7-methoxy-5,7-dioxo-2-(phenylmethoxycarbonylamino)heptanoic acid (PubChem CID 67830750) has the molecular formula C16H19NO7 and a molecular weight of 337.33 g/mol. Its IUPAC name is (2S)-7-methoxy-5,7-dioxo-2-(phenylmethoxycarbonylamino)heptanoic acid.
| Compound Name | (2S)-7-methoxy-5,7-dioxo-2-(phenylmethoxycarbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 67830750 |
| Molecular Formula | C16H19NO7 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (2S)-7-methoxy-5,7-dioxo-2-(phenylmethoxycarbonylamino)heptanoic acid |
| SMILES | COC(=O)CC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H19NO7/c1-23-14(19)9-12(18)7-8-13(15(20)21)17-16(22)24-10-11-5-3-2-4-6-11/h2-6,13H,7-10H2,1H3,(H,17,22)(H,20,21)/t13-/m0/s1 |
| InChIKey | HTPWNRVGTDARCE-ZDUSSCGKSA-N |
| XLogP | 1.28 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|