C18H27N2O6+ — CID 13474837
2-[4-carboxy-4-(phenylmethoxycarbonylamino)butanoyl]oxyethyl-trimethylazanium (PubChem CID 13474837) has the molecular formula C18H27N2O6+ and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-[4-carboxy-4-(phenylmethoxycarbonylamino)butanoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[4-carboxy-4-(phenylmethoxycarbonylamino)butanoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 13474837 |
| Molecular Formula | C18H27N2O6+ |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[4-carboxy-4-(phenylmethoxycarbonylamino)butanoyl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H26N2O6/c1-20(2,3)11-12-25-16(21)10-9-15(17(22)23)19-18(24)26-13-14-7-5-4-6-8-14/h4-8,15H,9-13H2,1-3H3,(H-,19,22,23,24)/p+1 |
| InChIKey | CKBSNOKDGYPVHR-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|