C13H17N2NaO5 — CID 173433388
sodium;(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid;hydride (PubChem CID 173433388) has the molecular formula C13H17N2NaO5 and a molecular weight of 304.28 g/mol. Its IUPAC name is sodium;(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid;hydride.
| Compound Name | sodium;(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid;hydride |
|---|---|
| PubChem CID | 173433388 |
| Molecular Formula | C13H17N2NaO5 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | sodium;(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid;hydride |
| SMILES | NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C13H16N2O5.Na.H/c14-11(16)7-6-10(12(17)18)15-13(19)20-8-9-4-2-1-3-5-9;;/h1-5,10H,6-8H2,(H2,14,16)(H,15,19)(H,17,18);;/q;+1;-1/t10-;;/m0../s1 |
| InChIKey | GAOMTXWGADEYBK-XRIOVQLTSA-N |
| XLogP | -2.25 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |