C21H22N2O6 — CID 7658599
phenacyl (2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 7658599) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is phenacyl (2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | phenacyl (2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 7658599 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | phenacyl (2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O6/c22-19(25)12-11-17(23-21(27)29-13-15-7-3-1-4-8-15)20(26)28-14-18(24)16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H2,22,25)(H,23,27)/t17-/m0/s1 |
| InChIKey | ZKMPPQXXKPBGLX-KRWDZBQOSA-N |
| XLogP | 1.97 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |