C19H21N5O5 — CID 18229677
benzyl N-[(2S)-5-amino-1,5-dioxo-1-[2-(pyridine-3-carbonyl)hydrazinyl]pentan-2-yl]carbamate (PubChem CID 18229677) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is benzyl N-[(2S)-5-amino-1,5-dioxo-1-[2-(pyridine-3-carbonyl)hydrazinyl]pentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-amino-1,5-dioxo-1-[2-(pyridine-3-carbonyl)hydrazinyl]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18229677 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | benzyl N-[(2S)-5-amino-1,5-dioxo-1-[2-(pyridine-3-carbonyl)hydrazinyl]pentan-2-yl]carbamate |
| SMILES | NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C19H21N5O5/c20-16(25)9-8-15(22-19(28)29-12-13-5-2-1-3-6-13)18(27)24-23-17(26)14-7-4-10-21-11-14/h1-7,10-11,15H,8-9,12H2,(H2,20,25)(H,22,28)(H,23,26)(H,24,27)/t15-/m0/s1 |
| InChIKey | DDXOARNRVQXLRU-HNNXBMFYSA-N |
| XLogP | 0.40 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|