C19H20IN3O4 — CID 24634676
benzyl N-[(2S)-5-amino-1-(3-iodoanilino)-1,5-dioxopentan-2-yl]carbamate (PubChem CID 24634676) has the molecular formula C19H20IN3O4 and a molecular weight of 481.29 g/mol. Its IUPAC name is benzyl N-[(2S)-5-amino-1-(3-iodoanilino)-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-amino-1-(3-iodoanilino)-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 24634676 |
| Molecular Formula | C19H20IN3O4 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | benzyl N-[(2S)-5-amino-1-(3-iodoanilino)-1,5-dioxopentan-2-yl]carbamate |
| SMILES | NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C19H20IN3O4/c20-14-7-4-8-15(11-14)22-18(25)16(9-10-17(21)24)23-19(26)27-12-13-5-2-1-3-6-13/h1-8,11,16H,9-10,12H2,(H2,21,24)(H,22,25)(H,23,26)/t16-/m0/s1 |
| InChIKey | LNIZUUJRDLOURH-INIZCTEOSA-N |
| XLogP | 2.79 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|