C26H26N2O6 — CID 70080867
methyl 5-oxo-5-(3-phenoxyanilino)-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 70080867) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is methyl 5-oxo-5-(3-phenoxyanilino)-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl 5-oxo-5-(3-phenoxyanilino)-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 70080867 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | methyl 5-oxo-5-(3-phenoxyanilino)-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H26N2O6/c1-32-24(29)16-15-23(28-26(31)33-18-19-9-4-2-5-10-19)25(30)27-20-11-8-14-22(17-20)34-21-12-6-3-7-13-21/h2-14,17,23H,15-16,18H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | RFSOETZTPCWBGD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |