C25H30N2O7 — CID 139811767
methyl 3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoyl]amino]benzoate (PubChem CID 139811767) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is methyl 3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoyl]amino]benzoate.
| Compound Name | methyl 3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 139811767 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | methyl 3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)[C@@H](CCC(=O)OCc2ccccc2)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H30N2O7/c1-25(2,3)34-24(31)27-20(13-14-21(28)33-16-17-9-6-5-7-10-17)22(29)26-19-12-8-11-18(15-19)23(30)32-4/h5-12,15,20H,13-14,16H2,1-4H3,(H,26,29)(H,27,31)/t20-/m1/s1 |
| InChIKey | NLRNAZOLMQXMSY-HXUWFJFHSA-N |
| XLogP | 3.83 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|