C25H30N2O5 — CID 101269009
benzyl 5-(4-ethenylanilino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 101269009) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is benzyl 5-(4-ethenylanilino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | benzyl 5-(4-ethenylanilino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 101269009 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | benzyl 5-(4-ethenylanilino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | C=Cc1ccc(NC(=O)C(CCC(=O)OCc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H30N2O5/c1-5-18-11-13-20(14-12-18)26-23(29)21(27-24(30)32-25(2,3)4)15-16-22(28)31-17-19-9-7-6-8-10-19/h5-14,21H,1,15-17H2,2-4H3,(H,26,29)(H,27,30) |
| InChIKey | QQEXSGAXVXKJTD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |