C22H27N3O4 — CID 90665505
benzyl N-[(2S)-8-amino-1-anilino-1,8-dioxooctan-2-yl]carbamate (PubChem CID 90665505) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is benzyl N-[(2S)-8-amino-1-anilino-1,8-dioxooctan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-8-amino-1-anilino-1,8-dioxooctan-2-yl]carbamate |
|---|---|
| PubChem CID | 90665505 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | benzyl N-[(2S)-8-amino-1-anilino-1,8-dioxooctan-2-yl]carbamate |
| SMILES | NC(=O)CCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H27N3O4/c23-20(26)15-9-3-8-14-19(21(27)24-18-12-6-2-7-13-18)25-22(28)29-16-17-10-4-1-5-11-17/h1-2,4-7,10-13,19H,3,8-9,14-16H2,(H2,23,26)(H,24,27)(H,25,28)/t19-/m0/s1 |
| InChIKey | SRANJUFKIHUEBG-IBGZPJMESA-N |
| XLogP | 3.36 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|