C30H32BrN3O6 — CID 87207025
benzyl N-[(2S)-1-[4-(2-bromoacetyl)anilino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate (PubChem CID 87207025) has the molecular formula C30H32BrN3O6 and a molecular weight of 610.51 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[4-(2-bromoacetyl)anilino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[4-(2-bromoacetyl)anilino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 87207025 |
| Molecular Formula | C30H32BrN3O6 |
| Molecular Weight | 610.51 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | benzyl N-[(2S)-1-[4-(2-bromoacetyl)anilino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
| SMILES | O=C(NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1ccc(C(=O)CBr)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H32BrN3O6/c31-19-27(35)24-14-16-25(17-15-24)33-28(36)26(34-30(38)40-21-23-11-5-2-6-12-23)13-7-8-18-32-29(37)39-20-22-9-3-1-4-10-22/h1-6,9-12,14-17,26H,7-8,13,18-21H2,(H,32,37)(H,33,36)(H,34,38)/t26-/m0/s1 |
| InChIKey | LCEHPUQALGIADG-SANMLTNESA-N |
| XLogP | 5.59 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|