C31H36N4O7 — CID 10460790
benzyl N-[[[(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]methyl]carbamate (PubChem CID 10460790) has the molecular formula C31H36N4O7 and a molecular weight of 576.65 g/mol. Its IUPAC name is benzyl N-[[[(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]methyl]carbamate.
| Compound Name | benzyl N-[[[(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]methyl]carbamate |
|---|---|
| PubChem CID | 10460790 |
| Molecular Formula | C31H36N4O7 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | benzyl N-[[[(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]methyl]carbamate |
| SMILES | O=C(NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)NCNC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H36N4O7/c36-28(33-23-34-30(38)41-21-25-14-6-2-7-15-25)27(35-31(39)42-22-26-16-8-3-9-17-26)18-10-11-19-32-29(37)40-20-24-12-4-1-5-13-24/h1-9,12-17,27H,10-11,18-23H2,(H,32,37)(H,33,36)(H,34,38)(H,35,39)/t27-/m0/s1 |
| InChIKey | ZHBKIMINDPZDRU-MHZLTWQESA-N |
| XLogP | 4.38 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|