C27H34N4O8 — CID 98141613
methyl 2-[[2-[[(2R)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]acetyl]amino]acetate (PubChem CID 98141613) has the molecular formula C27H34N4O8 and a molecular weight of 542.59 g/mol. Its IUPAC name is methyl 2-[[2-[[(2R)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[[(2R)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 98141613 |
| Molecular Formula | C27H34N4O8 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | methyl 2-[[2-[[(2R)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)CNC(=O)[C@@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H34N4O8/c1-37-24(33)17-29-23(32)16-30-25(34)22(31-27(36)39-19-21-12-6-3-7-13-21)14-8-9-15-28-26(35)38-18-20-10-4-2-5-11-20/h2-7,10-13,22H,8-9,14-19H2,1H3,(H,28,35)(H,29,32)(H,30,34)(H,31,36)/t22-/m1/s1 |
| InChIKey | CFHDKMPMUFCZIC-JOCHJYFZSA-N |
| XLogP | 1.78 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|