C19H27N3O7 — CID 53316725
methyl (2S)-2-[(2-methoxy-2-oxoethyl)carbamoylamino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 53316725) has the molecular formula C19H27N3O7 and a molecular weight of 409.44 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methoxy-2-oxoethyl)carbamoylamino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S)-2-[(2-methoxy-2-oxoethyl)carbamoylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 53316725 |
| Molecular Formula | C19H27N3O7 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | methyl (2S)-2-[(2-methoxy-2-oxoethyl)carbamoylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)CNC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C19H27N3O7/c1-27-16(23)12-21-18(25)22-15(17(24)28-2)10-6-7-11-20-19(26)29-13-14-8-4-3-5-9-14/h3-5,8-9,15H,6-7,10-13H2,1-2H3,(H,20,26)(H2,21,22,25)/t15-/m0/s1 |
| InChIKey | JWJXWBFBIAASNM-HNNXBMFYSA-N |
| XLogP | 1.10 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|