C29H40N4O7 — CID 11991078
methyl (2S)-2-[[(2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 11991078) has the molecular formula C29H40N4O7 and a molecular weight of 556.66 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 11991078 |
| Molecular Formula | C29H40N4O7 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H40N4O7/c1-38-27(35)25(17-9-11-19-32-29(37)40-21-23-14-6-3-7-15-23)33-26(34)24(30)16-8-10-18-31-28(36)39-20-22-12-4-2-5-13-22/h2-7,12-15,24-25H,8-11,16-21,30H2,1H3,(H,31,36)(H,32,37)(H,33,34)/t24-,25-/m0/s1 |
| InChIKey | XTKCMZNMGHADBV-DQEYMECFSA-N |
| XLogP | 3.16 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|