C23H35N3O8 — CID 142008477
methyl 2-[[(2R)-2-[1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 142008477) has the molecular formula C23H35N3O8 and a molecular weight of 481.55 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-[1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl 2-[[(2R)-2-[1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 142008477 |
| Molecular Formula | C23H35N3O8 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | methyl 2-[[(2R)-2-[1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)OCc1ccccc1)NC(=O)[C@H](CC(C)C)C(O)C(=O)NO |
| InChI | InChI=1S/C23H35N3O8/c1-15(2)13-17(19(27)21(29)26-32)20(28)25-18(22(30)33-3)11-7-8-12-24-23(31)34-14-16-9-5-4-6-10-16/h4-6,9-10,15,17-19,27,32H,7-8,11-14H2,1-3H3,(H,24,31)(H,25,28)(H,26,29)/t17-,18?,19?/m1/s1 |
| InChIKey | KQRHSNAAJGFEEE-LMDPOFIKSA-N |
| XLogP | 1.27 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|