C19H28N2O6S — CID 59050284
methyl (2R)-3-benzylsulfanyl-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]propanoate (PubChem CID 59050284) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is methyl (2R)-3-benzylsulfanyl-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]propanoate.
| Compound Name | methyl (2R)-3-benzylsulfanyl-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 59050284 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | methyl (2R)-3-benzylsulfanyl-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](CSCc1ccccc1)NC(=O)[C@H](CC(C)C)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C19H28N2O6S/c1-12(2)9-14(16(22)18(24)21-26)17(23)20-15(19(25)27-3)11-28-10-13-7-5-4-6-8-13/h4-8,12,14-16,22,26H,9-11H2,1-3H3,(H,20,23)(H,21,24)/t14-,15+,16+/m1/s1 |
| InChIKey | CHQPIPGQDKJYSK-PMPSAXMXSA-N |
| XLogP | 1.11 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|