C30H32N2O6S — CID 5147051
methyl 2-[2-(2-benzamido-2-phenylacetyl)oxybutanoylamino]-3-benzylsulfanylpropanoate (PubChem CID 5147051) has the molecular formula C30H32N2O6S and a molecular weight of 548.66 g/mol. Its IUPAC name is methyl 2-[2-(2-benzamido-2-phenylacetyl)oxybutanoylamino]-3-benzylsulfanylpropanoate.
| Compound Name | methyl 2-[2-(2-benzamido-2-phenylacetyl)oxybutanoylamino]-3-benzylsulfanylpropanoate |
|---|---|
| PubChem CID | 5147051 |
| Molecular Formula | C30H32N2O6S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | methyl 2-[2-(2-benzamido-2-phenylacetyl)oxybutanoylamino]-3-benzylsulfanylpropanoate |
| SMILES | CCC(OC(=O)C(NC(=O)c1ccccc1)c1ccccc1)C(=O)NC(CSCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C30H32N2O6S/c1-3-25(28(34)31-24(29(35)37-2)20-39-19-21-13-7-4-8-14-21)38-30(36)26(22-15-9-5-10-16-22)32-27(33)23-17-11-6-12-18-23/h4-18,24-26H,3,19-20H2,1-2H3,(H,31,34)(H,32,33) |
| InChIKey | UKYSMYSIFNPJJA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |