About 4-oxohexan-3-yl 2-benzamido-2-phenylacetate
4-oxohexan-3-yl 2-benzamido-2-phenylacetate (PubChem CID 118265046) has the molecular formula C21H23NO4
and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-oxohexan-3-yl 2-benzamido-2-phenylacetate.
Molecular Properties
| Compound Name | 4-oxohexan-3-yl 2-benzamido-2-phenylacetate |
| PubChem CID | 118265046 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-oxohexan-3-yl 2-benzamido-2-phenylacetate |
| SMILES | CCC(=O)C(CC)OC(=O)C(NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c1-3-17(23)18(4-2)26-21(25)19(15-11-7-5-8-12-15)22-20(24)16-13-9-6-10-14-16/h5-14,18-19H,3-4H2,1-2H3,(H,22,24) |
| InChIKey | HHDIJHXQEOORPI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxohexan-3-yl 2-benzamido-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxohexan-3-yl 2-benzamido-2-phenylacetate?
The IUPAC name of 4-oxohexan-3-yl 2-benzamido-2-phenylacetate (CID 118265046) is 4-oxohexan-3-yl 2-benzamido-2-phenylacetate.
What is the SMILES notation for 4-oxohexan-3-yl 2-benzamido-2-phenylacetate?
The canonical SMILES for 4-oxohexan-3-yl 2-benzamido-2-phenylacetate is CCC(=O)C(CC)OC(=O)C(NC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of 4-oxohexan-3-yl 2-benzamido-2-phenylacetate?
The InChIKey is HHDIJHXQEOORPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO4/c1-3-17(23)18(4-2)26-21(25)19(15-11-7-5-8-12-15)22-20(24)16-13-9-6-10-14-16/h5-14,18-19H,3-4H2,1-2H3,(H,22,24).
What are the key properties of 4-oxohexan-3-yl 2-benzamido-2-phenylacetate?
4-oxohexan-3-yl 2-benzamido-2-phenylacetate has a molecular weight of 353.42 g/mol, XLogP of 3.46, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxohexan-3-yl 2-benzamido-2-phenylacetate is sourced from PubChem (CID 118265046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).