C16H14BrNO3 — CID 40541065
methyl (2R)-2-[(3-bromobenzoyl)amino]-2-phenylacetate (PubChem CID 40541065) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is methyl (2R)-2-[(3-bromobenzoyl)amino]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[(3-bromobenzoyl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 40541065 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | methyl (2R)-2-[(3-bromobenzoyl)amino]-2-phenylacetate |
| SMILES | COC(=O)[C@H](NC(=O)c1cccc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C16H14BrNO3/c1-21-16(20)14(11-6-3-2-4-7-11)18-15(19)12-8-5-9-13(17)10-12/h2-10,14H,1H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | IZTHKHVCGLWUIY-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |