C22H18BrN3O4 — CID 171346842
3-bromo-N-[(1S)-2-[4-(hydroxycarbamoyl)anilino]-2-oxo-1-phenylethyl]benzamide (PubChem CID 171346842) has the molecular formula C22H18BrN3O4 and a molecular weight of 468.31 g/mol. Its IUPAC name is 3-bromo-N-[(1S)-2-[4-(hydroxycarbamoyl)anilino]-2-oxo-1-phenylethyl]benzamide.
| Compound Name | 3-bromo-N-[(1S)-2-[4-(hydroxycarbamoyl)anilino]-2-oxo-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 171346842 |
| Molecular Formula | C22H18BrN3O4 |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 3-bromo-N-[(1S)-2-[4-(hydroxycarbamoyl)anilino]-2-oxo-1-phenylethyl]benzamide |
| SMILES | O=C(NO)c1ccc(NC(=O)[C@@H](NC(=O)c2cccc(Br)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18BrN3O4/c23-17-8-4-7-16(13-17)20(27)25-19(14-5-2-1-3-6-14)22(29)24-18-11-9-15(10-12-18)21(28)26-30/h1-13,19,30H,(H,24,29)(H,25,27)(H,26,28)/t19-/m0/s1 |
| InChIKey | GKDSLRGHAAFGPK-IBGZPJMESA-N |
| XLogP | 3.68 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|