C23H29N3O4 — CID 72705315
N-hydroxy-4-[[(2S)-2-phenyl-2-(2-propylpentanoylamino)acetyl]amino]benzamide (PubChem CID 72705315) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-hydroxy-4-[[(2S)-2-phenyl-2-(2-propylpentanoylamino)acetyl]amino]benzamide.
| Compound Name | N-hydroxy-4-[[(2S)-2-phenyl-2-(2-propylpentanoylamino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 72705315 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-hydroxy-4-[[(2S)-2-phenyl-2-(2-propylpentanoylamino)acetyl]amino]benzamide |
| SMILES | CCCC(CCC)C(=O)N[C@H](C(=O)Nc1ccc(C(=O)NO)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O4/c1-3-8-17(9-4-2)21(27)25-20(16-10-6-5-7-11-16)23(29)24-19-14-12-18(13-15-19)22(28)26-30/h5-7,10-15,17,20,30H,3-4,8-9H2,1-2H3,(H,24,29)(H,25,27)(H,26,28)/t20-/m0/s1 |
| InChIKey | AYXIYXKIMUKEKQ-FQEVSTJZSA-N |
| XLogP | 3.82 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|