C17H16BrNO4 — CID 135065759
methyl (2R,3R)-2-benzamido-3-(3-bromophenyl)-3-hydroxypropanoate (PubChem CID 135065759) has the molecular formula C17H16BrNO4 and a molecular weight of 378.22 g/mol. Its IUPAC name is methyl (2R,3R)-2-benzamido-3-(3-bromophenyl)-3-hydroxypropanoate.
| Compound Name | methyl (2R,3R)-2-benzamido-3-(3-bromophenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 135065759 |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | methyl (2R,3R)-2-benzamido-3-(3-bromophenyl)-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](NC(=O)c1ccccc1)[C@H](O)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H16BrNO4/c1-23-17(22)14(15(20)12-8-5-9-13(18)10-12)19-16(21)11-6-3-2-4-7-11/h2-10,14-15,20H,1H3,(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | BFSDDOBEGLRWPX-HUUCEWRRSA-N |
| XLogP | 2.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |