C17H18N2O3 — CID 17393629
methyl 2-[3-(methylcarbamoyl)anilino]-2-phenylacetate (PubChem CID 17393629) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is methyl 2-[3-(methylcarbamoyl)anilino]-2-phenylacetate.
| Compound Name | methyl 2-[3-(methylcarbamoyl)anilino]-2-phenylacetate |
|---|---|
| PubChem CID | 17393629 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | methyl 2-[3-(methylcarbamoyl)anilino]-2-phenylacetate |
| SMILES | CNC(=O)c1cccc(NC(C(=O)OC)c2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2O3/c1-18-16(20)13-9-6-10-14(11-13)19-15(17(21)22-2)12-7-4-3-5-8-12/h3-11,15,19H,1-2H3,(H,18,20) |
| InChIKey | CBHAOQIQWRIOGR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |