C18H18N2O5 — CID 9007695
[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate (PubChem CID 9007695) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate.
| Compound Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 9007695 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate |
| SMILES | CNC(=O)c1cccc(NC(=O)COC(=O)[C@@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H18N2O5/c1-19-17(23)13-8-5-9-14(10-13)20-15(21)11-25-18(24)16(22)12-6-3-2-4-7-12/h2-10,16,22H,11H2,1H3,(H,19,23)(H,20,21)/t16-/m0/s1 |
| InChIKey | CGKIGWMYHXGWOL-INIZCTEOSA-N |
| XLogP | 1.26 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |