C18H19NO6 — CID 7834231
[2-(3,4-dimethoxyanilino)-2-oxoethyl] (2R)-2-hydroxy-2-phenylacetate (PubChem CID 7834231) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] (2R)-2-hydroxy-2-phenylacetate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] (2R)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 7834231 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] (2R)-2-hydroxy-2-phenylacetate |
| SMILES | COc1ccc(NC(=O)COC(=O)[C@H](O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H19NO6/c1-23-14-9-8-13(10-15(14)24-2)19-16(20)11-25-18(22)17(21)12-6-4-3-5-7-12/h3-10,17,21H,11H2,1-2H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | VLWHBQNYSZGKEZ-QGZVFWFLSA-N |
| XLogP | 1.92 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |