C24H21NO6 — CID 2371288
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 2371288) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-benzoylbenzoate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 2371288 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccccc2C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H21NO6/c1-29-20-13-12-17(14-21(20)30-2)25-22(26)15-31-24(28)19-11-7-6-10-18(19)23(27)16-8-4-3-5-9-16/h3-14H,15H2,1-2H3,(H,25,26) |
| InChIKey | WZAMPDMDHKZLCW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |