C25H23NO6 — CID 46619770
[1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-benzoylbenzoate (PubChem CID 46619770) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-benzoylbenzoate.
| Compound Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 46619770 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-benzoylbenzoate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)c2ccccc2C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H23NO6/c1-16(24(28)26-18-13-14-21(30-2)22(15-18)31-3)32-25(29)20-12-8-7-11-19(20)23(27)17-9-5-4-6-10-17/h4-16H,1-3H3,(H,26,28) |
| InChIKey | LWTDWJZJFCTJIY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |