C24H21NO4 — CID 3557338
[1-(4-methylanilino)-1-oxopropan-2-yl] 2-benzoylbenzoate (PubChem CID 3557338) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is [1-(4-methylanilino)-1-oxopropan-2-yl] 2-benzoylbenzoate.
| Compound Name | [1-(4-methylanilino)-1-oxopropan-2-yl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 3557338 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [1-(4-methylanilino)-1-oxopropan-2-yl] 2-benzoylbenzoate |
| SMILES | Cc1ccc(NC(=O)C(C)OC(=O)c2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO4/c1-16-12-14-19(15-13-16)25-23(27)17(2)29-24(28)21-11-7-6-10-20(21)22(26)18-8-4-3-5-9-18/h3-15,17H,1-2H3,(H,25,27) |
| InChIKey | HENRXHFVMQTFGD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |