C14H19NO5 — CID 7782633
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-methylpropanoate (PubChem CID 7782633) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-methylpropanoate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 7782633 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-methylpropanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)C(C)C)cc1OC |
| InChI | InChI=1S/C14H19NO5/c1-9(2)14(17)20-8-13(16)15-10-5-6-11(18-3)12(7-10)19-4/h5-7,9H,8H2,1-4H3,(H,15,16) |
| InChIKey | MGNYYFQEMWNWGB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |