C9H12N2O3 — CID 21197430
(3,4-dimethoxyphenyl)urea (PubChem CID 21197430) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)urea.
| Compound Name | (3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 21197430 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(N)=O)cc1OC |
| InChI | InChI=1S/C9H12N2O3/c1-13-7-4-3-6(11-9(10)12)5-8(7)14-2/h3-5H,1-2H3,(H3,10,11,12) |
| InChIKey | SZTJRKJVRLTIDX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |