C19H24N2O3 — CID 108866246
1-(4-tert-butylphenyl)-3-(3,4-dimethoxyphenyl)urea (PubChem CID 108866246) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108866246 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(C(C)(C)C)cc2)cc1OC |
| InChI | InChI=1S/C19H24N2O3/c1-19(2,3)13-6-8-14(9-7-13)20-18(22)21-15-10-11-16(23-4)17(12-15)24-5/h6-12H,1-5H3,(H2,20,21,22) |
| InChIKey | PDRZSLXOBDSWCQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |