C21H25N3O5 — CID 108969664
N-(4-acetamidophenyl)-N'-(3,4-dimethoxyphenyl)-2,2-dimethylpropanediamide (PubChem CID 108969664) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-N'-(3,4-dimethoxyphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(4-acetamidophenyl)-N'-(3,4-dimethoxyphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108969664 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-(4-acetamidophenyl)-N'-(3,4-dimethoxyphenyl)-2,2-dimethylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(C)(C)C(=O)Nc2ccc(NC(C)=O)cc2)cc1OC |
| InChI | InChI=1S/C21H25N3O5/c1-13(25)22-14-6-8-15(9-7-14)23-19(26)21(2,3)20(27)24-16-10-11-17(28-4)18(12-16)29-5/h6-12H,1-5H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | BWBWDXGPGIHDPM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|