C17H27N3O4 — CID 108960294
N-(3,4-dimethoxyphenyl)-N'-[2-(dimethylamino)ethyl]-2,2-dimethylpropanediamide (PubChem CID 108960294) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N'-[2-(dimethylamino)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N'-[2-(dimethylamino)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108960294 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N'-[2-(dimethylamino)ethyl]-2,2-dimethylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(C)(C)C(=O)NCCN(C)C)cc1OC |
| InChI | InChI=1S/C17H27N3O4/c1-17(2,15(21)18-9-10-20(3)4)16(22)19-12-7-8-13(23-5)14(11-12)24-6/h7-8,11H,9-10H2,1-6H3,(H,18,21)(H,19,22) |
| InChIKey | ACHIZJHBFFNLGR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|