C18H22N4O6 — CID 138619994
1-N',2-N'-bis(3,4-dimethoxyphenyl)ethanedihydrazide (PubChem CID 138619994) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is 1-N',2-N'-bis(3,4-dimethoxyphenyl)ethanedihydrazide.
| Compound Name | 1-N',2-N'-bis(3,4-dimethoxyphenyl)ethanedihydrazide |
|---|---|
| PubChem CID | 138619994 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-N',2-N'-bis(3,4-dimethoxyphenyl)ethanedihydrazide |
| SMILES | COc1ccc(NNC(=O)C(=O)NNc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C18H22N4O6/c1-25-13-7-5-11(9-15(13)27-3)19-21-17(23)18(24)22-20-12-6-8-14(26-2)16(10-12)28-4/h5-10,19-20H,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | YXXLDDRTCKDGRV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|