C9H11NO2S — CID 23047574
N-(3,4-dimethoxyphenyl)methanethioamide (PubChem CID 23047574) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)methanethioamide.
| Compound Name | N-(3,4-dimethoxyphenyl)methanethioamide |
|---|---|
| PubChem CID | 23047574 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)methanethioamide |
| SMILES | COc1ccc(NC=S)cc1OC |
| InChI | InChI=1S/C9H11NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-6H,1-2H3,(H,10,13) |
| InChIKey | UOXCGJZEOJGNSL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|