About O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate
O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate (PubChem CID 86738118) has the molecular formula C12H14ClNO2S
and a molecular weight of 271.77 g/mol. Its IUPAC name is O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate.
Molecular Properties
| Compound Name | O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate |
| PubChem CID | 86738118 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate |
| SMILES | COC(=S)C(C)=CNc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClNO2S/c1-8(12(17)16-3)7-14-9-4-5-11(15-2)10(13)6-9/h4-7,14H,1-3H3 |
| InChIKey | CRBKJDJZJKXHOD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate?
The IUPAC name of O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate (CID 86738118) is O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate.
What is the SMILES notation for O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate?
The canonical SMILES for O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate is COC(=S)C(C)=CNc1ccc(OC)c(Cl)c1.
What is the InChIKey of O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate?
The InChIKey is CRBKJDJZJKXHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO2S/c1-8(12(17)16-3)7-14-9-4-5-11(15-2)10(13)6-9/h4-7,14H,1-3H3.
What are the key properties of O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate?
O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate has a molecular weight of 271.77 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl 3-(3-chloro-4-methoxyanilino)-2-methylprop-2-enethioate is sourced from PubChem (CID 86738118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).