C14H12Cl2N2OS — CID 19677525
1-(3-chloro-4-methoxyphenyl)-3-(3-chlorophenyl)thiourea (PubChem CID 19677525) has the molecular formula C14H12Cl2N2OS and a molecular weight of 327.24 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 19677525 |
| Molecular Formula | C14H12Cl2N2OS |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(3-chlorophenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2OS/c1-19-13-6-5-11(8-12(13)16)18-14(20)17-10-4-2-3-9(15)7-10/h2-8H,1H3,(H2,17,18,20) |
| InChIKey | FFGLUYHSYKQLPS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|