C16H18ClN3O3S2 — CID 46800265
1-(3-chloro-4-methoxyphenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea (PubChem CID 46800265) has the molecular formula C16H18ClN3O3S2 and a molecular weight of 399.93 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 46800265 |
| Molecular Formula | C16H18ClN3O3S2 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
| SMILES | COc1ccc(NC(=S)Nc2cccc(S(=O)(=O)N(C)C)c2)cc1Cl |
| InChI | InChI=1S/C16H18ClN3O3S2/c1-20(2)25(21,22)13-6-4-5-11(9-13)18-16(24)19-12-7-8-15(23-3)14(17)10-12/h4-10H,1-3H3,(H2,18,19,24) |
| InChIKey | YUWMUBMUZSZOSG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|